C15H20BrF — CID 105376025
2-[[1-(bromomethyl)cyclohexyl]methyl]-4-fluoro-1-methylbenzene (PubChem CID 105376025) has the molecular formula C15H20BrF and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-[[1-(bromomethyl)cyclohexyl]methyl]-4-fluoro-1-methylbenzene.
| Compound Name | 2-[[1-(bromomethyl)cyclohexyl]methyl]-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 105376025 |
| Molecular Formula | C15H20BrF |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[[1-(bromomethyl)cyclohexyl]methyl]-4-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(F)cc1CC1(CBr)CCCCC1 |
| InChI | InChI=1S/C15H20BrF/c1-12-5-6-14(17)9-13(12)10-15(11-16)7-3-2-4-8-15/h5-6,9H,2-4,7-8,10-11H2,1H3 |
| InChIKey | GLBAVUAJLIQELY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|