2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid

C14H19NO2 — CID 77074142

IUPAC2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid
SMILESCC(=CCN(C)c1ccc(C)cc1C)C(=O)O
InChIInChI=1S/C14H19NO2/c1-10-5-6-13(12(3)9-10)15(4)8-7-11(2)14(16)17/h5-7,9H,8H2,1-4H3,(H,16,17)
InChIKeyOTQAFEIFNPNZDM-UHFFFAOYSA-N
MW233.31 g/mol
LogP2.77
Rot. Bonds4

About 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid

2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid (PubChem CID 77074142) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid.

Molecular Properties

Compound Name2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid
PubChem CID77074142
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid
SMILESCC(=CCN(C)c1ccc(C)cc1C)C(=O)O
InChIInChI=1S/C14H19NO2/c1-10-5-6-13(12(3)9-10)15(4)8-7-11(2)14(16)17/h5-7,9H,8H2,1-4H3,(H,16,17)
InChIKeyOTQAFEIFNPNZDM-UHFFFAOYSA-N
XLogP2.77
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid?
The IUPAC name of 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid (CID 77074142) is 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid.
What is the SMILES notation for 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid?
The canonical SMILES for 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid is CC(=CCN(C)c1ccc(C)cc1C)C(=O)O.
What is the InChIKey of 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid?
The InChIKey is OTQAFEIFNPNZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10-5-6-13(12(3)9-10)15(4)8-7-11(2)14(16)17/h5-7,9H,8H2,1-4H3,(H,16,17).
What are the key properties of 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid?
2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid has a molecular weight of 233.31 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(N,2,4-trimethylanilino)but-2-enoic acid is sourced from PubChem (CID 77074142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).