C15H24N2OS — CID 54981703
N'-methyl-N-(1-oxothian-4-yl)-N'-phenylpropane-1,3-diamine (PubChem CID 54981703) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is N'-methyl-N-(1-oxothian-4-yl)-N'-phenylpropane-1,3-diamine.
| Compound Name | N'-methyl-N-(1-oxothian-4-yl)-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 54981703 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N'-methyl-N-(1-oxothian-4-yl)-N'-phenylpropane-1,3-diamine |
| SMILES | CN(CCCNC1CCS(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H24N2OS/c1-17(15-6-3-2-4-7-15)11-5-10-16-14-8-12-19(18)13-9-14/h2-4,6-7,14,16H,5,8-13H2,1H3 |
| InChIKey | IVNRJACROFCMPG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|