C14H19N3O2 — CID 43637779
3-[3-(N-methylanilino)propylamino]pyrrolidine-2,5-dione (PubChem CID 43637779) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[3-(N-methylanilino)propylamino]pyrrolidine-2,5-dione.
| Compound Name | 3-[3-(N-methylanilino)propylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637779 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[3-(N-methylanilino)propylamino]pyrrolidine-2,5-dione |
| SMILES | CN(CCCNC1CC(=O)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O2/c1-17(11-6-3-2-4-7-11)9-5-8-15-12-10-13(18)16-14(12)19/h2-4,6-7,12,15H,5,8-10H2,1H3,(H,16,18,19) |
| InChIKey | NUVPQQDXDHPPSX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|