C12H13ClN2O2 — CID 71670669
3-[2-(3-chlorophenyl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 71670669) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | 3-[2-(3-chlorophenyl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71670669 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCc2cccc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-9-3-1-2-8(6-9)4-5-14-10-7-11(16)15-12(10)17/h1-3,6,10,14H,4-5,7H2,(H,15,16,17) |
| InChIKey | WWMKRODUGXQBEL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|