C13H21NO — CID 62226910
5-(N,4-dimethylanilino)pentan-1-ol (PubChem CID 62226910) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-(N,4-dimethylanilino)pentan-1-ol.
| Compound Name | 5-(N,4-dimethylanilino)pentan-1-ol |
|---|---|
| PubChem CID | 62226910 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 5-(N,4-dimethylanilino)pentan-1-ol |
| SMILES | Cc1ccc(N(C)CCCCCO)cc1 |
| InChI | InChI=1S/C13H21NO/c1-12-6-8-13(9-7-12)14(2)10-4-3-5-11-15/h6-9,15H,3-5,10-11H2,1-2H3 |
| InChIKey | ITMSKBHDCMYKIK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|