C14H22N2OS — CID 107703805
4-[6-hydroxyhexyl(methyl)amino]benzenecarbothioamide (PubChem CID 107703805) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-[6-hydroxyhexyl(methyl)amino]benzenecarbothioamide.
| Compound Name | 4-[6-hydroxyhexyl(methyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107703805 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[6-hydroxyhexyl(methyl)amino]benzenecarbothioamide |
| SMILES | CN(CCCCCCO)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C14H22N2OS/c1-16(10-4-2-3-5-11-17)13-8-6-12(7-9-13)14(15)18/h6-9,17H,2-5,10-11H2,1H3,(H2,15,18) |
| InChIKey | IXJREUYYAMRNHK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|