C14H19F3N2OS — CID 107199811
4-[5-hydroxypentyl(methyl)amino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 107199811) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 4-[5-hydroxypentyl(methyl)amino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[5-hydroxypentyl(methyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107199811 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[5-hydroxypentyl(methyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CN(CCCCCO)c1ccc(C(N)=S)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2OS/c1-19(7-3-2-4-8-20)10-5-6-11(13(18)21)12(9-10)14(15,16)17/h5-6,9,20H,2-4,7-8H2,1H3,(H2,18,21) |
| InChIKey | BKWLMBDLEURPGY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|