C13H17F3N2OS — CID 61425931
4-[2-hydroxyethyl(propyl)amino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 61425931) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(propyl)amino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[2-hydroxyethyl(propyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 61425931 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[2-hydroxyethyl(propyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CCCN(CCO)c1ccc(C(N)=S)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2OS/c1-2-5-18(6-7-19)9-3-4-10(12(17)20)11(8-9)13(14,15)16/h3-4,8,19H,2,5-7H2,1H3,(H2,17,20) |
| InChIKey | ITBXPMNWVCNIIN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|