C16H28N2O — CID 62260445
N-(4-methoxyphenyl)-N,N',2-trimethyl-2-propylpropane-1,3-diamine (PubChem CID 62260445) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N,N',2-trimethyl-2-propylpropane-1,3-diamine.
| Compound Name | N-(4-methoxyphenyl)-N,N',2-trimethyl-2-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62260445 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-(4-methoxyphenyl)-N,N',2-trimethyl-2-propylpropane-1,3-diamine |
| SMILES | CCCC(C)(CNC)CN(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H28N2O/c1-6-11-16(2,12-17-3)13-18(4)14-7-9-15(19-5)10-8-14/h7-10,17H,6,11-13H2,1-5H3 |
| InChIKey | PMARIBIZPMRNGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|