C13H21BO6 — CID 154810192
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxycarbonyl-2-methylfuran-3-yl)borinic acid (PubChem CID 154810192) has the molecular formula C13H21BO6 and a molecular weight of 284.12 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxycarbonyl-2-methylfuran-3-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxycarbonyl-2-methylfuran-3-yl)borinic acid |
|---|---|
| PubChem CID | 154810192 |
| Molecular Formula | C13H21BO6 |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxycarbonyl-2-methylfuran-3-yl)borinic acid |
| SMILES | COC(=O)c1cc(B(O)OC(C)(C)C(C)(C)O)c(C)o1 |
| InChI | InChI=1S/C13H21BO6/c1-8-9(7-10(19-8)11(15)18-6)14(17)20-13(4,5)12(2,3)16/h7,16-17H,1-6H3 |
| InChIKey | RAXLLSMUBSPNGQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|