C15H23BO5 — CID 56844576
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(3-methoxycarbonyl-5-methylphenyl)borinic acid (PubChem CID 56844576) has the molecular formula C15H23BO5 and a molecular weight of 294.16 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(3-methoxycarbonyl-5-methylphenyl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(3-methoxycarbonyl-5-methylphenyl)borinic acid |
|---|---|
| PubChem CID | 56844576 |
| Molecular Formula | C15H23BO5 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(3-methoxycarbonyl-5-methylphenyl)borinic acid |
| SMILES | COC(=O)c1cc(C)cc(B(O)OC(C)(C)C(C)(C)O)c1 |
| InChI | InChI=1S/C15H23BO5/c1-10-7-11(13(17)20-6)9-12(8-10)16(19)21-15(4,5)14(2,3)18/h7-9,18-19H,1-6H3 |
| InChIKey | DXWIVSXELODGKO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|