C18H29BO6 — CID 56844584
(3-butoxy-5-methoxycarbonylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 56844584) has the molecular formula C18H29BO6 and a molecular weight of 352.24 g/mol. Its IUPAC name is (3-butoxy-5-methoxycarbonylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (3-butoxy-5-methoxycarbonylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 56844584 |
| Molecular Formula | C18H29BO6 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (3-butoxy-5-methoxycarbonylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCCCOc1cc(B(O)OC(C)(C)C(C)(C)O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H29BO6/c1-7-8-9-24-15-11-13(16(20)23-6)10-14(12-15)19(22)25-18(4,5)17(2,3)21/h10-12,21-22H,7-9H2,1-6H3 |
| InChIKey | UWLBNASWYRCVSP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|