C16H24BNO4 — CID 67067513
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-(2-methylprop-2-enoylamino)phenyl]borinic acid (PubChem CID 67067513) has the molecular formula C16H24BNO4 and a molecular weight of 305.18 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-(2-methylprop-2-enoylamino)phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-(2-methylprop-2-enoylamino)phenyl]borinic acid |
|---|---|
| PubChem CID | 67067513 |
| Molecular Formula | C16H24BNO4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-(2-methylprop-2-enoylamino)phenyl]borinic acid |
| SMILES | C=C(C)C(=O)Nc1ccccc1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C16H24BNO4/c1-11(2)14(19)18-13-10-8-7-9-12(13)17(21)22-16(5,6)15(3,4)20/h7-10,20-21H,1H2,2-6H3,(H,18,19) |
| InChIKey | ZWQJELHUPSNTCC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|