C12H11BClF4NO3 — CID 139658887
[2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-(2-methylprop-2-enoylamino)phenyl]boronic acid (PubChem CID 139658887) has the molecular formula C12H11BClF4NO3 and a molecular weight of 339.48 g/mol. Its IUPAC name is [2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-(2-methylprop-2-enoylamino)phenyl]boronic acid.
| Compound Name | [2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-(2-methylprop-2-enoylamino)phenyl]boronic acid |
|---|---|
| PubChem CID | 139658887 |
| Molecular Formula | C12H11BClF4NO3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-(2-chloro-1,1,2,2-tetrafluoroethyl)-3-(2-methylprop-2-enoylamino)phenyl]boronic acid |
| SMILES | C=C(C)C(=O)Nc1cccc(B(O)O)c1C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C12H11BClF4NO3/c1-6(2)10(20)19-8-5-3-4-7(13(21)22)9(8)11(15,16)12(14,17)18/h3-5,21-22H,1H2,2H3,(H,19,20) |
| InChIKey | KGARVJWQNHVYEY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|