C20H10BF22NO3 — CID 139621761
[5-(2-methylprop-2-enoylamino)-2,4-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]boronic acid (PubChem CID 139621761) has the molecular formula C20H10BF22NO3 and a molecular weight of 741.07 g/mol. Its IUPAC name is [5-(2-methylprop-2-enoylamino)-2,4-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]boronic acid.
| Compound Name | [5-(2-methylprop-2-enoylamino)-2,4-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 139621761 |
| Molecular Formula | C20H10BF22NO3 |
| Molecular Weight | 741.07 g/mol |
| Exact Mass | 741.04 |
| IUPAC Name | [5-(2-methylprop-2-enoylamino)-2,4-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]boronic acid |
| SMILES | C=C(C)C(=O)Nc1cc(B(O)O)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H10BF22NO3/c1-5(2)10(45)44-9-4-8(21(46)47)6(11(22,23)13(26,27)15(30,31)17(34,35)19(38,39)40)3-7(9)12(24,25)14(28,29)16(32,33)18(36,37)20(41,42)43/h3-4,46-47H,1H2,2H3,(H,44,45) |
| InChIKey | OKTIPRXWYSMTLR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.07 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|