C13H8F3N3O — CID 16756279
N-[2,4-dicyano-5-(trifluoromethyl)phenyl]-2-methylprop-2-enamide (PubChem CID 16756279) has the molecular formula C13H8F3N3O and a molecular weight of 279.22 g/mol. Its IUPAC name is N-[2,4-dicyano-5-(trifluoromethyl)phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[2,4-dicyano-5-(trifluoromethyl)phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 16756279 |
| Molecular Formula | C13H8F3N3O |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-[2,4-dicyano-5-(trifluoromethyl)phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cc(C(F)(F)F)c(C#N)cc1C#N |
| InChI | InChI=1S/C13H8F3N3O/c1-7(2)12(20)19-11-4-10(13(14,15)16)8(5-17)3-9(11)6-18/h3-4H,1H2,2H3,(H,19,20) |
| InChIKey | AAFKNZNQOLLKBA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|