C15H18BrF3N2O2 — CID 155732291
(2R)-3-bromo-N-[4-cyano-2-methyl-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;ethane (PubChem CID 155732291) has the molecular formula C15H18BrF3N2O2 and a molecular weight of 395.22 g/mol. Its IUPAC name is (2R)-3-bromo-N-[4-cyano-2-methyl-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;ethane.
| Compound Name | (2R)-3-bromo-N-[4-cyano-2-methyl-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;ethane |
|---|---|
| PubChem CID | 155732291 |
| Molecular Formula | C15H18BrF3N2O2 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2R)-3-bromo-N-[4-cyano-2-methyl-5-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide;ethane |
| SMILES | CC.Cc1cc(C#N)c(C(F)(F)F)cc1NC(=O)[C@@](C)(O)CBr |
| InChI | InChI=1S/C13H12BrF3N2O2.C2H6/c1-7-3-8(5-18)9(13(15,16)17)4-10(7)19-11(20)12(2,21)6-14;1-2/h3-4,21H,6H2,1-2H3,(H,19,20);1-2H3/t12-;/m0./s1 |
| InChIKey | RULNJWREDWNZNT-YDALLXLXSA-N |
| XLogP | 4.00 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|