C16H15F4IN4O2 — CID 155350772
(2S)-N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]-3-[[(E)-2-fluoroprop-1-enyl]-(methylideneamino)amino]-2-hydroxy-2-methylpropanamide (PubChem CID 155350772) has the molecular formula C16H15F4IN4O2 and a molecular weight of 498.22 g/mol. Its IUPAC name is (2S)-N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]-3-[[(E)-2-fluoroprop-1-enyl]-(methylideneamino)amino]-2-hydroxy-2-methylpropanamide.
| Compound Name | (2S)-N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]-3-[[(E)-2-fluoroprop-1-enyl]-(methylideneamino)amino]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 155350772 |
| Molecular Formula | C16H15F4IN4O2 |
| Molecular Weight | 498.22 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | (2S)-N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]-3-[[(E)-2-fluoroprop-1-enyl]-(methylideneamino)amino]-2-hydroxy-2-methylpropanamide |
| SMILES | C=NN(/C=C(\C)F)C[C@](C)(O)C(=O)Nc1cc(C(F)(F)F)c(C#N)cc1I |
| InChI | InChI=1S/C16H15F4IN4O2/c1-9(17)7-25(23-3)8-15(2,27)14(26)24-13-5-11(16(18,19)20)10(6-22)4-12(13)21/h4-5,7,27H,3,8H2,1-2H3,(H,24,26)/b9-7+/t15-/m0/s1 |
| InChIKey | NWIWFCKTSKRCGS-HEWZJLJBSA-N |
| XLogP | 3.62 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|