C10H8F3IN2O2S — CID 171678543
N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 171678543) has the molecular formula C10H8F3IN2O2S and a molecular weight of 404.15 g/mol. Its IUPAC name is N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 171678543 |
| Molecular Formula | C10H8F3IN2O2S |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | N-[4-cyano-2-iodo-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc(C(F)(F)F)c(C#N)cc1I |
| InChI | InChI=1S/C10H8F3IN2O2S/c1-2-19(17,18)16-9-4-7(10(11,12)13)6(5-15)3-8(9)14/h3-4,16H,2H2,1H3 |
| InChIKey | YFFQBWSHQZVFQR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|