C13H13BrN2O4 — CID 68958667
methyl 5-[(3-bromo-2-hydroxy-2-methylpropanoyl)amino]-2-cyanobenzoate (PubChem CID 68958667) has the molecular formula C13H13BrN2O4 and a molecular weight of 341.16 g/mol. Its IUPAC name is methyl 5-[(3-bromo-2-hydroxy-2-methylpropanoyl)amino]-2-cyanobenzoate.
| Compound Name | methyl 5-[(3-bromo-2-hydroxy-2-methylpropanoyl)amino]-2-cyanobenzoate |
|---|---|
| PubChem CID | 68958667 |
| Molecular Formula | C13H13BrN2O4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | methyl 5-[(3-bromo-2-hydroxy-2-methylpropanoyl)amino]-2-cyanobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)C(C)(O)CBr)ccc1C#N |
| InChI | InChI=1S/C13H13BrN2O4/c1-13(19,7-14)12(18)16-9-4-3-8(6-15)10(5-9)11(17)20-2/h3-5,19H,7H2,1-2H3,(H,16,18) |
| InChIKey | CAAYCXLOUDCASO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|