C10H11BrF5NO2S — CID 166441361
(2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]propanamide (PubChem CID 166441361) has the molecular formula C10H11BrF5NO2S and a molecular weight of 384.16 g/mol. Its IUPAC name is (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]propanamide.
| Compound Name | (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 166441361 |
| Molecular Formula | C10H11BrF5NO2S |
| Molecular Weight | 384.16 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]propanamide |
| SMILES | C[C@](O)(CBr)C(=O)Nc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11BrF5NO2S/c1-10(19,6-11)9(18)17-7-2-4-8(5-3-7)20(12,13,14,15)16/h2-5,19H,6H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | JFLFZRXWTVIMQL-JTQLQIEISA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|