C12H16F5NOS — CID 177287967
2,2-dimethyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]butanamide (PubChem CID 177287967) has the molecular formula C12H16F5NOS and a molecular weight of 317.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]butanamide.
| Compound Name | 2,2-dimethyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 177287967 |
| Molecular Formula | C12H16F5NOS |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2,2-dimethyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]butanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F5NOS/c1-4-12(2,3)11(19)18-9-5-7-10(8-6-9)20(13,14,15,16)17/h5-8H,4H2,1-3H3,(H,18,19) |
| InChIKey | TUBNXJZTTBOEIZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |