C12H10BrF3N2O2 — CID 59140696
(2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(113C)methylidyne(15N)azaniumyl-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 59140696) has the molecular formula C12H10BrF3N2O2 and a molecular weight of 353.11 g/mol. Its IUPAC name is (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(113C)methylidyne(15N)azaniumyl-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(113C)methylidyne(15N)azaniumyl-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 59140696 |
| Molecular Formula | C12H10BrF3N2O2 |
| Molecular Weight | 353.11 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (2R)-3-bromo-2-hydroxy-2-methyl-N-[4-(113C)methylidyne(15N)azaniumyl-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@](O)(CBr)C(=O)Nc1ccc([15N+]#[13C-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10BrF3N2O2/c1-11(20,6-13)10(19)18-7-3-4-9(17-2)8(5-7)12(14,15)16/h3-5,20H,6H2,1H3,(H,18,19)/t11-/m0/s1/i2+1,17+1 |
| InChIKey | ABIVNWFSNNXSBK-PZAGJLRISA-N |
| XLogP | 3.34 |
| TPSA | 53.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|