C13H17ClN2O2 — CID 160756711
(2S)-N-(3-chloro-4-isocyanophenyl)-2-hydroxy-2-methylbutanamide;methane (PubChem CID 160756711) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-isocyanophenyl)-2-hydroxy-2-methylbutanamide;methane.
| Compound Name | (2S)-N-(3-chloro-4-isocyanophenyl)-2-hydroxy-2-methylbutanamide;methane |
|---|---|
| PubChem CID | 160756711 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2S)-N-(3-chloro-4-isocyanophenyl)-2-hydroxy-2-methylbutanamide;methane |
| SMILES | C.[C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)CC)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O2.CH4/c1-4-12(2,17)11(16)15-8-5-6-10(14-3)9(13)7-8;/h5-7,17H,4H2,1-2H3,(H,15,16);1H4/t12-;/m0./s1 |
| InChIKey | RXNJQHKQKOMPJC-YDALLXLXSA-N |
| XLogP | 3.63 |
| TPSA | 53.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|