C20H19F3N4O3 — CID 58618825
(2S)-3-(4-acetamidoanilino)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methylpropanamide (PubChem CID 58618825) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is (2S)-3-(4-acetamidoanilino)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methylpropanamide.
| Compound Name | (2S)-3-(4-acetamidoanilino)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58618825 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2S)-3-(4-acetamidoanilino)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)CNc2ccc(NC(C)=O)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3/c1-12(28)26-14-6-4-13(5-7-14)25-11-19(2,30)18(29)27-15-8-9-17(24-3)16(10-15)20(21,22)23/h4-10,25,30H,11H2,1-2H3,(H,26,28)(H,27,29)/t19-/m0/s1 |
| InChIKey | KHXSQFFOLQJOIR-IBGZPJMESA-N |
| XLogP | 4.02 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|