C22H20F3N5O2 — CID 59855244
3-[(4-acetamidophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide (PubChem CID 59855244) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 3-[(4-acetamidophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide.
| Compound Name | 3-[(4-acetamidophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59855244 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[(4-acetamidophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C2(C)CC(Cc3ccc(NC(C)=O)cc3)=NN2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N5O2/c1-13(31)27-15-6-4-14(5-7-15)10-17-12-21(2,30-29-17)20(32)28-16-8-9-19(26-3)18(11-16)22(23,24)25/h4-9,11,30H,10,12H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | HTHPNWFNDLIDTB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|