C15H14F3N3O — CID 167577383
N-(4-isocyano-3-methylphenyl)-3-methyl-5-(trifluoromethyl)-2,4-dihydropyrrole-3-carboxamide (PubChem CID 167577383) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is N-(4-isocyano-3-methylphenyl)-3-methyl-5-(trifluoromethyl)-2,4-dihydropyrrole-3-carboxamide.
| Compound Name | N-(4-isocyano-3-methylphenyl)-3-methyl-5-(trifluoromethyl)-2,4-dihydropyrrole-3-carboxamide |
|---|---|
| PubChem CID | 167577383 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(4-isocyano-3-methylphenyl)-3-methyl-5-(trifluoromethyl)-2,4-dihydropyrrole-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C2(C)CN=C(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C15H14F3N3O/c1-9-6-10(4-5-11(9)19-3)21-13(22)14(2)7-12(20-8-14)15(16,17)18/h4-6H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | QHTLMKWYHOKCRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|