C15H19N3O2S — CID 58510311
(2E)-2-tert-butylsulfinylimino-N-(4-isocyano-3-methylphenyl)propanamide (PubChem CID 58510311) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2E)-2-tert-butylsulfinylimino-N-(4-isocyano-3-methylphenyl)propanamide.
| Compound Name | (2E)-2-tert-butylsulfinylimino-N-(4-isocyano-3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 58510311 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2E)-2-tert-butylsulfinylimino-N-(4-isocyano-3-methylphenyl)propanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)/C(C)=N/S(=O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H19N3O2S/c1-10-9-12(7-8-13(10)16-6)17-14(19)11(2)18-21(20)15(3,4)5/h7-9H,1-5H3,(H,17,19)/b18-11+ |
| InChIKey | OQIDKZNBSFQQCM-WOJGMQOQSA-N |
| XLogP | 3.41 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|