C14H16F4N2O2S — CID 154043890
N-[3-[N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-4-fluorophenyl]-2,2,2-trifluoroacetamide (PubChem CID 154043890) has the molecular formula C14H16F4N2O2S and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[3-[N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-4-fluorophenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-4-fluorophenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 154043890 |
| Molecular Formula | C14H16F4N2O2S |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[3-[N-[(R)-tert-butylsulfinyl]-C-methylcarbonimidoyl]-4-fluorophenyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=N[S@](=O)C(C)(C)C)c1cc(NC(=O)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H16F4N2O2S/c1-8(20-23(22)13(2,3)4)10-7-9(5-6-11(10)15)19-12(21)14(16,17)18/h5-7H,1-4H3,(H,19,21)/t23-/m1/s1 |
| InChIKey | WTMNWNLIEJJQRU-HSZRJFAPSA-N |
| XLogP | 3.60 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|