C10H4F9NO — CID 19958570
N-[3,4-bis(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 19958570) has the molecular formula C10H4F9NO and a molecular weight of 325.13 g/mol. Its IUPAC name is N-[3,4-bis(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3,4-bis(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 19958570 |
| Molecular Formula | C10H4F9NO |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-[3,4-bis(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C10H4F9NO/c11-8(12,13)5-2-1-4(3-6(5)9(14,15)16)20-7(21)10(17,18)19/h1-3H,(H,20,21) |
| InChIKey | WVGKGRMQFYQSIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |