C11H8BrF6NO — CID 174762130
N-[4-(2-bromoethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 174762130) has the molecular formula C11H8BrF6NO and a molecular weight of 364.08 g/mol. Its IUPAC name is N-[4-(2-bromoethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(2-bromoethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 174762130 |
| Molecular Formula | C11H8BrF6NO |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-[4-(2-bromoethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(CCBr)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H8BrF6NO/c12-4-3-6-1-2-7(5-8(6)10(13,14)15)19-9(20)11(16,17)18/h1-2,5H,3-4H2,(H,19,20) |
| InChIKey | RXGSPQHLIBNFQM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|