C10H4ClF6NO2S — CID 151439111
S-chloro 2-[3,4-bis(trifluoromethyl)anilino]-2-oxoethanethioate (PubChem CID 151439111) has the molecular formula C10H4ClF6NO2S and a molecular weight of 351.66 g/mol. Its IUPAC name is S-chloro 2-[3,4-bis(trifluoromethyl)anilino]-2-oxoethanethioate.
| Compound Name | S-chloro 2-[3,4-bis(trifluoromethyl)anilino]-2-oxoethanethioate |
|---|---|
| PubChem CID | 151439111 |
| Molecular Formula | C10H4ClF6NO2S |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | S-chloro 2-[3,4-bis(trifluoromethyl)anilino]-2-oxoethanethioate |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1)C(=O)SCl |
| InChI | InChI=1S/C10H4ClF6NO2S/c11-21-8(20)7(19)18-4-1-2-5(9(12,13)14)6(3-4)10(15,16)17/h1-3H,(H,18,19) |
| InChIKey | PEDMRRDAHAOPHG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|