C11H10BrClN2O — CID 58553088
2-bromo-N-(3-chloro-4-isocyanophenyl)-2-methylpropanamide (PubChem CID 58553088) has the molecular formula C11H10BrClN2O and a molecular weight of 301.57 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-4-isocyanophenyl)-2-methylpropanamide.
| Compound Name | 2-bromo-N-(3-chloro-4-isocyanophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 58553088 |
| Molecular Formula | C11H10BrClN2O |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 2-bromo-N-(3-chloro-4-isocyanophenyl)-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C(C)(C)Br)cc1Cl |
| InChI | InChI=1S/C11H10BrClN2O/c1-11(2,12)10(16)15-7-4-5-9(14-3)8(13)6-7/h4-6H,1-2H3,(H,15,16) |
| InChIKey | SNUFWXRJIYUXGF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|