C11H9ClN2O2 — CID 140851065
(2S)-N-(3-chloro-4-isocyanophenyl)-2-methyloxirane-2-carboxamide (PubChem CID 140851065) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-isocyanophenyl)-2-methyloxirane-2-carboxamide.
| Compound Name | (2S)-N-(3-chloro-4-isocyanophenyl)-2-methyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 140851065 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2S)-N-(3-chloro-4-isocyanophenyl)-2-methyloxirane-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@]2(C)CO2)cc1Cl |
| InChI | InChI=1S/C11H9ClN2O2/c1-11(6-16-11)10(15)14-7-3-4-9(13-2)8(12)5-7/h3-5H,6H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | DTSQZUNISWAOMB-NSHDSACASA-N |
| XLogP | 2.62 |
| TPSA | 45.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|