C11H8ClF3N2O2 — CID 123406953
(2R)-N-(3-chloro-4-isocyanophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (PubChem CID 123406953) has the molecular formula C11H8ClF3N2O2 and a molecular weight of 292.64 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-isocyanophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide.
| Compound Name | (2R)-N-(3-chloro-4-isocyanophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 123406953 |
| Molecular Formula | C11H8ClF3N2O2 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (2R)-N-(3-chloro-4-isocyanophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H8ClF3N2O2/c1-10(19,11(13,14)15)9(18)17-6-3-4-8(16-2)7(12)5-6/h3-5,19H,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | LOVOQZHDLKRNCU-SNVBAGLBSA-N |
| XLogP | 3.14 |
| TPSA | 53.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|