C18H17ClN2O3 — CID 59140709
(2S)-N-(3-chloro-4-(113C)methylidyne(15N)azaniumylphenyl)-2-hydroxy-2-methyl-3-(4-methylphenoxy)propanamide (PubChem CID 59140709) has the molecular formula C18H17ClN2O3 and a molecular weight of 346.78 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-(113C)methylidyne(15N)azaniumylphenyl)-2-hydroxy-2-methyl-3-(4-methylphenoxy)propanamide.
| Compound Name | (2S)-N-(3-chloro-4-(113C)methylidyne(15N)azaniumylphenyl)-2-hydroxy-2-methyl-3-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 59140709 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2S)-N-(3-chloro-4-(113C)methylidyne(15N)azaniumylphenyl)-2-hydroxy-2-methyl-3-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OC[C@](C)(O)C(=O)Nc2ccc([15N+]#[13C-])c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-12-4-7-14(8-5-12)24-11-18(2,23)17(22)21-13-6-9-16(20-3)15(19)10-13/h4-10,23H,11H2,1-2H3,(H,21,22)/t18-/m0/s1/i3+1,20+1 |
| InChIKey | VRZQBROSEQWCIN-JISIRLQNSA-N |
| XLogP | 3.97 |
| TPSA | 62.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|