C20H17F4N3O3S — CID 161329776
fluoromethane;(2R)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenoxy)-2-methylpropanamide (PubChem CID 161329776) has the molecular formula C20H17F4N3O3S and a molecular weight of 455.43 g/mol. Its IUPAC name is fluoromethane;(2R)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenoxy)-2-methylpropanamide.
| Compound Name | fluoromethane;(2R)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 161329776 |
| Molecular Formula | C20H17F4N3O3S |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | fluoromethane;(2R)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenoxy)-2-methylpropanamide |
| SMILES | CF.[C-]#[N+]c1ccc(NC(=O)[C@](C)(O)COc2ccc(N=C=S)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3O3S.CH3F/c1-18(27,10-28-14-6-3-12(4-7-14)24-11-29)17(26)25-13-5-8-16(23-2)15(9-13)19(20,21)22;1-2/h3-9,27H,10H2,1H3,(H,25,26);1H3/t18-;/m1./s1 |
| InChIKey | VLGNBRBLONJWGH-GMUIIQOCSA-N |
| XLogP | 5.34 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|