C19H14F3N3O4S2 — CID 58601425
(2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenyl)sulfonyl-2-methylpropanamide (PubChem CID 58601425) has the molecular formula C19H14F3N3O4S2 and a molecular weight of 469.47 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | (2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 58601425 |
| Molecular Formula | C19H14F3N3O4S2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-(4-isothiocyanatophenyl)sulfonyl-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@](C)(O)CS(=O)(=O)c2ccc(N=C=S)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3O4S2/c1-18(27,10-31(28,29)14-6-3-12(4-7-14)24-11-30)17(26)25-13-5-8-16(23-2)15(9-13)19(20,21)22/h3-9,27H,10H2,1H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | RPFPRIGRASMBEQ-GOSISDBHSA-N |
| XLogP | 4.15 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|