C18H14F3N3O6S2 — CID 58601422
(2S)-2-hydroxy-3-(4-isothiocyanatophenyl)sulfonyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 58601422) has the molecular formula C18H14F3N3O6S2 and a molecular weight of 489.45 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(4-isothiocyanatophenyl)sulfonyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-hydroxy-3-(4-isothiocyanatophenyl)sulfonyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 58601422 |
| Molecular Formula | C18H14F3N3O6S2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | (2S)-2-hydroxy-3-(4-isothiocyanatophenyl)sulfonyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@](O)(CS(=O)(=O)c1ccc(N=C=S)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O6S2/c1-17(26,9-32(29,30)13-5-2-11(3-6-13)22-10-31)16(25)23-12-4-7-15(24(27)28)14(8-12)18(19,20)21/h2-8,26H,9H2,1H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | CEFRVXZOLNMWKD-QGZVFWFLSA-N |
| XLogP | 3.51 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|