C21H21F3N2O4SSn — CID 59903816
[4-[(2R)-2-hydroxy-3-[4-isocyano-3-(trifluoromethyl)anilino]-2-methyl-3-oxopropyl]sulfonylphenyl]-propyltin (PubChem CID 59903816) has the molecular formula C21H21F3N2O4SSn and a molecular weight of 573.18 g/mol. Its IUPAC name is [4-[(2R)-2-hydroxy-3-[4-isocyano-3-(trifluoromethyl)anilino]-2-methyl-3-oxopropyl]sulfonylphenyl]-propyltin.
| Compound Name | [4-[(2R)-2-hydroxy-3-[4-isocyano-3-(trifluoromethyl)anilino]-2-methyl-3-oxopropyl]sulfonylphenyl]-propyltin |
|---|---|
| PubChem CID | 59903816 |
| Molecular Formula | C21H21F3N2O4SSn |
| Molecular Weight | 573.18 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | [4-[(2R)-2-hydroxy-3-[4-isocyano-3-(trifluoromethyl)anilino]-2-methyl-3-oxopropyl]sulfonylphenyl]-propyltin |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)CS(=O)(=O)c2ccc([Sn]CCC)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14F3N2O4S.C3H7.Sn/c1-17(25,11-28(26,27)13-6-4-3-5-7-13)16(24)23-12-8-9-15(22-2)14(10-12)18(19,20)21;1-3-2;/h4-10,25H,11H2,1H3,(H,23,24);1,3H2,2H3;/t17-;;/m0../s1 |
| InChIKey | NTAXMXDCUZAGCJ-RMRYJAPISA-N |
| XLogP | 3.58 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|