C25H30N2O6S — CID 159422757
7-[4-[(2S)-2-hydroxy-3-(4-isocyano-3-methylanilino)-2-methyl-3-oxopropyl]sulfonylphenyl]heptanoic acid (PubChem CID 159422757) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 7-[4-[(2S)-2-hydroxy-3-(4-isocyano-3-methylanilino)-2-methyl-3-oxopropyl]sulfonylphenyl]heptanoic acid.
| Compound Name | 7-[4-[(2S)-2-hydroxy-3-(4-isocyano-3-methylanilino)-2-methyl-3-oxopropyl]sulfonylphenyl]heptanoic acid |
|---|---|
| PubChem CID | 159422757 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 7-[4-[(2S)-2-hydroxy-3-(4-isocyano-3-methylanilino)-2-methyl-3-oxopropyl]sulfonylphenyl]heptanoic acid |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@](C)(O)CS(=O)(=O)c2ccc(CCCCCCC(=O)O)cc2)cc1C |
| InChI | InChI=1S/C25H30N2O6S/c1-18-16-20(12-15-22(18)26-3)27-24(30)25(2,31)17-34(32,33)21-13-10-19(11-14-21)8-6-4-5-7-9-23(28)29/h10-16,31H,4-9,17H2,1-2H3,(H,27,30)(H,28,29)/t25-/m1/s1 |
| InChIKey | RQLNVJBFGKATMH-RUZDIDTESA-N |
| XLogP | 4.29 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|