C24H19F3N2O4S — CID 88553855
(2R)-2-[(3,5-difluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)propanamide (PubChem CID 88553855) has the molecular formula C24H19F3N2O4S and a molecular weight of 488.49 g/mol. Its IUPAC name is (2R)-2-[(3,5-difluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)propanamide.
| Compound Name | (2R)-2-[(3,5-difluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 88553855 |
| Molecular Formula | C24H19F3N2O4S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (2R)-2-[(3,5-difluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)propanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@](O)(Cc2cc(F)cc(F)c2)CS(=O)(=O)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C24H19F3N2O4S/c1-15-9-20(5-8-22(15)28-2)29-23(30)24(31,13-16-10-18(26)12-19(27)11-16)14-34(32,33)21-6-3-17(25)4-7-21/h3-12,31H,13-14H2,1H3,(H,29,30)/t24-/m0/s1 |
| InChIKey | PIPWIPIXRSWYPI-DEOSSOPVSA-N |
| XLogP | 4.35 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|