C20H15F6NO4S — CID 158286776
4-(4-fluorophenyl)sulfonyl-3-hydroxy-1-[4-isocyano-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-methylbutan-2-one (PubChem CID 158286776) has the molecular formula C20H15F6NO4S and a molecular weight of 479.40 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-3-hydroxy-1-[4-isocyano-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-3-hydroxy-1-[4-isocyano-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158286776 |
| Molecular Formula | C20H15F6NO4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-3-hydroxy-1-[4-isocyano-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)C(C)(O)CS(=O)(=O)c2ccc(F)cc2)cc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H15F6NO4S/c1-18(29,11-32(30,31)14-6-4-13(21)5-7-14)17(28)10-12-3-8-16(27-2)15(9-12)19(22,23)20(24,25)26/h3-9,29H,10-11H2,1H3 |
| InChIKey | BIBGWVLEVPXGQM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|