C19H14F4N4O2 — CID 158915950
(3S)-4-(5-fluorobenzotriazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one (PubChem CID 158915950) has the molecular formula C19H14F4N4O2 and a molecular weight of 406.34 g/mol. Its IUPAC name is (3S)-4-(5-fluorobenzotriazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-(5-fluorobenzotriazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158915950 |
| Molecular Formula | C19H14F4N4O2 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (3S)-4-(5-fluorobenzotriazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2nnc3cc(F)ccc32)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F4N4O2/c1-18(29,10-27-16-6-4-12(20)9-15(16)25-26-27)17(28)8-11-3-5-14(24-2)13(7-11)19(21,22)23/h3-7,9,29H,8,10H2,1H3/t18-/m0/s1 |
| InChIKey | JHFPRHGSTHZJAS-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|