C17H16F3N3O — CID 160974575
1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-3-(3-methylpyrazol-1-yl)butan-2-one (PubChem CID 160974575) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-3-(3-methylpyrazol-1-yl)butan-2-one.
| Compound Name | 1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-3-(3-methylpyrazol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 160974575 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-3-(3-methylpyrazol-1-yl)butan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)C(C)(C)n2ccc(C)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O/c1-11-7-8-23(22-11)16(2,3)15(24)10-12-5-6-14(21-4)13(9-12)17(18,19)20/h5-9H,10H2,1-3H3 |
| InChIKey | AADULRHLDCMMIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|