C21H18F3N3O2 — CID 157307666
(3S)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-4-(5-methylindazol-2-yl)butan-2-one (PubChem CID 157307666) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-4-(5-methylindazol-2-yl)butan-2-one.
| Compound Name | (3S)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-4-(5-methylindazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 157307666 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3S)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-4-(5-methylindazol-2-yl)butan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2cc3cc(C)ccc3n2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O2/c1-13-4-6-17-15(8-13)11-27(26-17)12-20(2,29)19(28)10-14-5-7-18(25-3)16(9-14)21(22,23)24/h4-9,11,29H,10,12H2,1-2H3/t20-/m0/s1 |
| InChIKey | WRUSAEPUUKIXON-FQEVSTJZSA-N |
| XLogP | 4.48 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|