C16H18N4O2 — CID 147482281
(3S)-4-(4-aminopyrazol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one (PubChem CID 147482281) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (3S)-4-(4-aminopyrazol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one.
| Compound Name | (3S)-4-(4-aminopyrazol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 147482281 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3S)-4-(4-aminopyrazol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2cc(N)cn2)cc1C |
| InChI | InChI=1S/C16H18N4O2/c1-11-6-12(4-5-14(11)18-3)7-15(21)16(2,22)10-20-9-13(17)8-19-20/h4-6,8-9,22H,7,10,17H2,1-2H3/t16-/m0/s1 |
| InChIKey | FDWVPPNHDCQVBU-INIZCTEOSA-N |
| XLogP | 1.89 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|