C25H21ClN2O2 — CID 158467360
(3S)-1-(3-chloro-4-isocyanophenyl)-3-hydroxy-3-methyl-4-(3-methylcarbazol-9-yl)butan-2-one (PubChem CID 158467360) has the molecular formula C25H21ClN2O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-isocyanophenyl)-3-hydroxy-3-methyl-4-(3-methylcarbazol-9-yl)butan-2-one.
| Compound Name | (3S)-1-(3-chloro-4-isocyanophenyl)-3-hydroxy-3-methyl-4-(3-methylcarbazol-9-yl)butan-2-one |
|---|---|
| PubChem CID | 158467360 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3S)-1-(3-chloro-4-isocyanophenyl)-3-hydroxy-3-methyl-4-(3-methylcarbazol-9-yl)butan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2c3ccccc3c3cc(C)ccc32)cc1Cl |
| InChI | InChI=1S/C25H21ClN2O2/c1-16-8-11-23-19(12-16)18-6-4-5-7-22(18)28(23)15-25(2,30)24(29)14-17-9-10-21(27-3)20(26)13-17/h4-13,30H,14-15H2,1-2H3/t25-/m0/s1 |
| InChIKey | HOOYXVVZAGWDPR-VWLOTQADSA-N |
| XLogP | 5.87 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|