C21H17F4N3O2 — CID 157184735
(3S)-4-(4-fluorobenzimidazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylpentan-2-one (PubChem CID 157184735) has the molecular formula C21H17F4N3O2 and a molecular weight of 419.38 g/mol. Its IUPAC name is (3S)-4-(4-fluorobenzimidazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylpentan-2-one.
| Compound Name | (3S)-4-(4-fluorobenzimidazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylpentan-2-one |
|---|---|
| PubChem CID | 157184735 |
| Molecular Formula | C21H17F4N3O2 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (3S)-4-(4-fluorobenzimidazol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylpentan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)C(C)n2cnc3c(F)cccc32)cc1C(F)(F)F |
| InChI | InChI=1S/C21H17F4N3O2/c1-12(28-11-27-19-15(22)5-4-6-17(19)28)20(2,30)18(29)10-13-7-8-16(26-3)14(9-13)21(23,24)25/h4-9,11-12,30H,10H2,1-2H3/t12?,20-/m0/s1 |
| InChIKey | QJOITYBRTPRLAU-UDRWWJRQSA-N |
| XLogP | 4.87 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|